CAS 54507-44-7 appears in our catalog under these names: 2-Iodo-4-(trifluoromethyl)benzoic acid 98%, 2-Iodo-4-(trifluoromethyl)benzoic acid, 98%, 98%, 2-Iodo-4-(trifluoromethyl)benzoic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 10g.
2-iodo-4-(trifluoromethyl)benzoic acid (CAS 54507-44-7) is a chemical compound with the molecular formula C8H4F3IO2 and a molecular weight of 316.02 g/mol. IUPAC name: 2-iodo-4-(trifluoromethyl)benzoic acid. InChIKey: WCLYLTXCKMZNOH-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO2 |
|---|---|
| Molecular weight | 316.02 g/mol |
| IUPAC name | 2-iodo-4-(trifluoromethyl)benzoic acid |
| InChIKey | WCLYLTXCKMZNOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)I)C(=O)O |
Computed by PubChem (NCBI)