Products 1034690-61-3
CAS 1034690-61-3 appears in our catalog under these names: 3-Iodo-4-(trifluoromethyl)benzoic acid, 98%, 3-Iodo-4-(trifluoromethyl)benzoic acid, 97%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 1g, 5g, 250mg, 100mg.
3-iodo-4-(trifluoromethyl)benzoic acid (CAS 1034690-61-3) is a chemical compound with the molecular formula C8H4F3IO2 and a molecular weight of 316.02 g/mol. IUPAC name: 3-iodo-4-(trifluoromethyl)benzoic acid. InChIKey: WNJDSOAQPKABJD-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO2 |
|---|---|
| Molecular weight | 316.02 g/mol |
| IUPAC name | 3-iodo-4-(trifluoromethyl)benzoic acid |
| InChIKey | WNJDSOAQPKABJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)I)C(F)(F)F |
Computed by PubChem (NCBI)