cas: 1009376-98-0 — see every product listed under this CAS number, including other names
1-tert-Butyl 3-methyl (3s,6r)-6-methylpiperidine-1,3-dicarboxylate, 95% (CAS 1009376-98-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 500mg, 1g, 5g, 10g. Offered by: Combi-blocks, Chemat, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QW-5973-250mg |
| cas | 1009376-98-0 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Chemat | 100mg | 626.00 Pln | |
| Chemat | 250mg | 818.00 Pln | |
| Chemat | 500mg | 933.20 Pln | |
| Chemat | 1g | 1547.60 Pln | |
| Chemat | 5g | 5992.40 Pln | |
| Chemat | 10g | 11051.60 Pln | |
| Fluorochem | 100mg | 1148.57 Pln | |
| Fluorochem | 250mg | 1513.03 Pln | |
| Fluorochem | 500mg | 1716.08 Pln | |
| Fluorochem | 1g | 2882.34 Pln | |
| Fluorochem | 5g | 10926.38 Pln | |
| Fluorochem | 10g | 20188.74 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1-O-tert-butyl 3-O-methyl (3S,6R)-6-methylpiperidine-1,3-dicarboxylate (CAS 1009376-98-0) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S,6R)-6-methylpiperidine-1,3-dicarboxylate. InChIKey: HDRXORRYMWSTTC-ZJUUUORDSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3S,6R)-6-methylpiperidine-1,3-dicarboxylate |
| InChIKey | HDRXORRYMWSTTC-ZJUUUORDSA-N |
| SMILES | C[C@@H]1CC[C@@H](CN1C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)