CAS 1009377-05-2 is the registry number for 1-tert-Butyl 3-methyl (3r,6s)-6-methylpiperidine-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
1-O-tert-butyl 3-O-methyl (3R,6S)-6-methylpiperidine-1,3-dicarboxylate (CAS 1009377-05-2) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3R,6S)-6-methylpiperidine-1,3-dicarboxylate. InChIKey: HDRXORRYMWSTTC-VHSXEESVSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3R,6S)-6-methylpiperidine-1,3-dicarboxylate |
| InChIKey | HDRXORRYMWSTTC-VHSXEESVSA-N |
| SMILES | C[C@H]1CC[C@H](CN1C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)