CAS 1009376-75-3 appears in our catalog under these names: Trans-6-methyl-piperidine-1,3-dicarboxylic acid 1-tert-butyl ester 3-methyl ester, 95%, trans-1-tert-Butyl 3-methyl 6-methylpiperidine-1,3-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
1-O-tert-butyl 3-O-methyl (3R,6R)-6-methylpiperidine-1,3-dicarboxylate (CAS 1009376-75-3) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3R,6R)-6-methylpiperidine-1,3-dicarboxylate. InChIKey: HDRXORRYMWSTTC-NXEZZACHSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3R,6R)-6-methylpiperidine-1,3-dicarboxylate |
| InChIKey | HDRXORRYMWSTTC-NXEZZACHSA-N |
| SMILES | C[C@@H]1CC[C@H](CN1C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)