CAS 1009376-98-0 appears in our catalog under these names: 1-tert-Butyl 3-methyl (3s,6r)-6-methylpiperidine-1,3-dicarboxylate, 95%, 1-tert-Butyl 3-methyl (3s,6r)-6-methylpiperidine-1,3-dicarboxylate, 97%, 1-tert-Butyl 3-methyl (3s,6r)-6-methylpiperidine-1,3-dicarboxylate, 95%, 95%, 1-tert-butyl 3-methyl (3S,6R)-6-methylpiperidine-1,3-dicarboxylate, 96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 10g, 100mg, 500mg, 1g.
1-O-tert-butyl 3-O-methyl (3S,6R)-6-methylpiperidine-1,3-dicarboxylate (CAS 1009376-98-0) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S,6R)-6-methylpiperidine-1,3-dicarboxylate. InChIKey: HDRXORRYMWSTTC-ZJUUUORDSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3S,6R)-6-methylpiperidine-1,3-dicarboxylate |
| InChIKey | HDRXORRYMWSTTC-ZJUUUORDSA-N |
| SMILES | C[C@@H]1CC[C@@H](CN1C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)