cas: 1415740-83-8 — see every product listed under this CAS number, including other names
1-tert-Butyl 4-methyl 2-methylpiperidine-1,4-dicarboxylate 96% (CAS 1415740-83-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A361009-100mg |
| cas | 1415740-83-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 915.50 Pln | |
| Ambeed | 250mg | 1093.50 Pln | |
| Ambeed | 1g | 2450.75 Pln | |
| Ambeed | 5g | 6745.00 Pln | |
| Ambeed | 10g | 10966.94 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A361009 |
1-O-tert-butyl 4-O-methyl 2-methylpiperidine-1,4-dicarboxylate (CAS 1415740-83-8) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 2-methylpiperidine-1,4-dicarboxylate. InChIKey: MVHJLPVFTFKCGA-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl 2-methylpiperidine-1,4-dicarboxylate |
| InChIKey | MVHJLPVFTFKCGA-UHFFFAOYSA-N |
| SMILES | CC1CC(CCN1C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)