cas: 885068-10-0 — see every product listed under this CAS number, including other names
1H-Indazol-6-yl-6-boronic acid 97% (CAS 885068-10-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A172155-1g |
| cas | 885068-10-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 320.31 Pln | |
| Ambeed | 10g | 542.81 Pln | |
| Ambeed | 25g | 1193.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A172155 |
1H-indazol-6-ylboronic acid (CAS 885068-10-0) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: 1H-indazol-6-ylboronic acid. InChIKey: ZKNLCHWRWRYPGG-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | 1H-indazol-6-ylboronic acid |
| InChIKey | ZKNLCHWRWRYPGG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=NN2)(O)O |
Computed by PubChem (NCBI)