cas: 53714-66-2 — see every product listed under this CAS number, including other names
2',3'-Dichloro-(1,1'-biphenyl)-4-ol, 95% (CAS 53714-66-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A225036-10g |
| cas | 53714-66-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10733.38 Pln | |
| AmBeed | 5g | 6840.40 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(2,3-dichlorophenyl)phenol (CAS 53714-66-2) is a chemical compound with the molecular formula C12H8Cl2O and a molecular weight of 239.09 g/mol. IUPAC name: 4-(2,3-dichlorophenyl)phenol. InChIKey: UTOHHFUBWXQVRN-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | 4-(2,3-dichlorophenyl)phenol |
| InChIKey | UTOHHFUBWXQVRN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)