cas: 54996-07-5 — see every product listed under this CAS number, including other names
2,2,6,6-TETRAMETHYLPIPERIDINE-4-CARBOXYLIC ACID HCL (CAS 54996-07-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DDBR-50mg |
| cas | 54996-07-5 |
| size | 50mg |
| availability | 1.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 1158.80 Pln | |
| Chemat | 250mg | 2349.20 Pln |
| delivery time | 3 weeks |
|---|
2,2,6,6-tetramethylpiperidine-4-carboxylic acid;hydrochloride (CAS 54996-07-5) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: 2,2,6,6-tetramethylpiperidine-4-carboxylic acid;hydrochloride. InChIKey: QSWMAXHNUDWBLI-UHFFFAOYSA-N.
| Molecular formula | C10H20ClNO2 |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | 2,2,6,6-tetramethylpiperidine-4-carboxylic acid;hydrochloride |
| InChIKey | QSWMAXHNUDWBLI-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1)(C)C)C(=O)O)C.Cl |
Computed by PubChem (NCBI)