cas: 206360-56-7 — see every product listed under this CAS number, including other names
2,2-Difluoro-2-(4-nitrophenyl)acetic acid, 95% (CAS 206360-56-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218495-250MG |
| cas | 206360-56-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 1127.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2,2-difluoro-2-(4-nitrophenyl)acetic acid (CAS 206360-56-7) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2,2-difluoro-2-(4-nitrophenyl)acetic acid. InChIKey: RZESONLWCQFNHX-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 2,2-difluoro-2-(4-nitrophenyl)acetic acid |
| InChIKey | RZESONLWCQFNHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)