cas: 206360-56-7 — see every product listed under this CAS number, including other names
Difluoro(4-nitrophenyl)acetic acid, 95-<97% (CAS 206360-56-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC7162-95-97-5g |
| cas | 206360-56-7 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 6011.72 Pln | |
| Hoffman Fine Chemicals | 10g | 9431.40 Pln | |
| Hoffman Fine Chemicals | 25g | 18561.18 Pln | |
| Hoffman Fine Chemicals | 50g | 29509.26 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2,2-difluoro-2-(4-nitrophenyl)acetic acid (CAS 206360-56-7) is a chemical compound with the molecular formula C8H5F2NO4 and a molecular weight of 217.13 g/mol. IUPAC name: 2,2-difluoro-2-(4-nitrophenyl)acetic acid. InChIKey: RZESONLWCQFNHX-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO4 |
|---|---|
| Molecular weight | 217.13 g/mol |
| IUPAC name | 2,2-difluoro-2-(4-nitrophenyl)acetic acid |
| InChIKey | RZESONLWCQFNHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)