cas: 15231-78-4 — see every product listed under this CAS number, including other names
2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione 97% (CAS 15231-78-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A343810-250mg |
| cas | 15231-78-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 259.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A343810 |
2,2-dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS 15231-78-4) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: 2,2-dimethyl-5-phenyl-1,3-dioxane-4,6-dione. InChIKey: NTUAHNQWHPQAMB-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 2,2-dimethyl-5-phenyl-1,3-dioxane-4,6-dione |
| InChIKey | NTUAHNQWHPQAMB-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)