cas: 15231-78-4 — see every product listed under this CAS number, including other names
2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione, 97%, 97% (CAS 15231-78-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FBJ-100mg |
| cas | 15231-78-4 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 194.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,2-dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS 15231-78-4) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: 2,2-dimethyl-5-phenyl-1,3-dioxane-4,6-dione. InChIKey: NTUAHNQWHPQAMB-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 2,2-dimethyl-5-phenyl-1,3-dioxane-4,6-dione |
| InChIKey | NTUAHNQWHPQAMB-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)