cas: 157373-08-5 — see every product listed under this CAS number, including other names
2,3,4-Trifluorobenzoyl Chloride, >98.0%(T) (CAS 157373-08-5) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T1868-5G |
| cas | 157373-08-5 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 847.59 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
2,3,4-trifluorobenzoyl chloride (CAS 157373-08-5) is a chemical compound with the molecular formula C7H2ClF3O and a molecular weight of 194.54 g/mol. IUPAC name: 2,3,4-trifluorobenzoyl chloride. InChIKey: NXRQXCFBZGIRGN-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3O |
|---|---|
| Molecular weight | 194.54 g/mol |
| IUPAC name | 2,3,4-trifluorobenzoyl chloride |
| InChIKey | NXRQXCFBZGIRGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)Cl)F)F)F |
Computed by PubChem (NCBI)