cas: 157373-08-5 — see every product listed under this CAS number, including other names
2,3,4-Trifluorobenzoyl chloride, 98% (CAS 157373-08-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007494-1G |
| cas | 157373-08-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 25g | 560.24 Pln | |
| Fluorochem | 100g | 1664.02 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2,3,4-trifluorobenzoyl chloride (CAS 157373-08-5) is a chemical compound with the molecular formula C7H2ClF3O and a molecular weight of 194.54 g/mol. IUPAC name: 2,3,4-trifluorobenzoyl chloride. InChIKey: NXRQXCFBZGIRGN-UHFFFAOYSA-N.
| Molecular formula | C7H2ClF3O |
|---|---|
| Molecular weight | 194.54 g/mol |
| IUPAC name | 2,3,4-trifluorobenzoyl chloride |
| InChIKey | NXRQXCFBZGIRGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)Cl)F)F)F |
Computed by PubChem (NCBI)