2,3,5,6-Tetrafluoro-1,4-phenylenediamine, 98%
cas: 1198-64-7 — see every product listed under this CAS number, including other names
2,3,5,6-Tetrafluoro-1,4-phenylenediamine, 98% (CAS 1198-64-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, BLDpharm, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch111POR-100mg |
| cas | 1198-64-7 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 894.80 Pln | |
| Chemat | 5g | 2968.40 Pln | |
| BLDpharm | 100mg | 436.54 Pln | |
| BLDpharm | 250mg | 680.90 Pln | |
| BLDpharm | 1g | 1658.33 Pln | |
| BLDpharm | 5g | 5634.71 Pln | |
| BLDpharm | 10g | 9527.78 Pln | |
| Fluorochem | 100mg | 414.46 Pln | |
| Fluorochem | 250mg | 633.13 Pln | |
| Fluorochem | 1g | 1591.12 Pln | |
| Fluorochem | 5g | 5287.74 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3,5,6-tetrafluorobenzene-1,4-diamine (CAS 1198-64-7) is a chemical compound with the molecular formula C6H4F4N2 and a molecular weight of 180.10 g/mol. IUPAC name: 2,3,5,6-tetrafluorobenzene-1,4-diamine. InChIKey: FVFYRXJKYAVFSB-UHFFFAOYSA-N.
| Molecular formula | C6H4F4N2 |
|---|---|
| Molecular weight | 180.10 g/mol |
| IUPAC name | 2,3,5,6-tetrafluorobenzene-1,4-diamine |
| InChIKey | FVFYRXJKYAVFSB-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)N)F)F)N |
Computed by PubChem (NCBI)
Synonyms:
2,3,5,6-Tetrafluorobenzene-1,4-diamine, 1,4-Benzenediamine, 2,3,5,6-tetrafluoro-, Tetrafluoro-p-phenylenediamine, 2,3,5,6-Tetrafluoro-1,4-phenylenediamine, 1,4-Diaminotetrafluorobenzene, 1,4-Diamino-2,3,5,6-tetrafluorobenzene, tetrafluorobenzene-1,4-diamine, Perfluorobenzene-1,4-diamine, 2,3,5,6-Tetrafluoro-1,4-benzenediamine, 2,3,5,6-Tetrafluoro-p-phenylenediamine