cas: 1451392-13-4 — see every product listed under this CAS number, including other names
2,3-Dimethoxy-6-fluorophenylboronic acid (CAS 1451392-13-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F628038-1G |
| cas | 1451392-13-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2788.62 Pln |
| delivery time | 3-4 weeks |
|---|
(6-fluoro-2,3-dimethoxyphenyl)boronic acid (CAS 1451392-13-4) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (6-fluoro-2,3-dimethoxyphenyl)boronic acid. InChIKey: NLUMLIMEFPUAGS-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (6-fluoro-2,3-dimethoxyphenyl)boronic acid |
| InChIKey | NLUMLIMEFPUAGS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1OC)OC)F)(O)O |
Computed by PubChem (NCBI)