cas: 643093-74-7 — see every product listed under this CAS number, including other names
2,3-Dimethyl-4-formylphenylboronic acid (CAS 643093-74-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F628089-1G |
| cas | 643093-74-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1502.61 Pln | |
| Fluorochem | 5g | 4376.60 Pln |
| delivery time | 3-4 weeks |
|---|
(4-formyl-2,3-dimethylphenyl)boronic acid (CAS 643093-74-7) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: (4-formyl-2,3-dimethylphenyl)boronic acid. InChIKey: VWKSRDYVNJKHOI-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | (4-formyl-2,3-dimethylphenyl)boronic acid |
| InChIKey | VWKSRDYVNJKHOI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C=O)C)C)(O)O |
Computed by PubChem (NCBI)