cas: 1198-63-6 — see every product listed under this CAS number, including other names
2,4,5,6-Tetrafluoro-1,3-phenylenediamine, >95.0%(GC) (CAS 1198-63-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T2019-1G |
| cas | 1198-63-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 369.12 Pln | |
| TCI | 5g | 1111.63 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
2,4,5,6-tetrafluorobenzene-1,3-diamine (CAS 1198-63-6) is a chemical compound with the molecular formula C6H4F4N2 and a molecular weight of 180.10 g/mol. IUPAC name: 2,4,5,6-tetrafluorobenzene-1,3-diamine. InChIKey: FXGQUGCFZKMIJW-UHFFFAOYSA-N.
| Molecular formula | C6H4F4N2 |
|---|---|
| Molecular weight | 180.10 g/mol |
| IUPAC name | 2,4,5,6-tetrafluorobenzene-1,3-diamine |
| InChIKey | FXGQUGCFZKMIJW-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)N)F)N |
Computed by PubChem (NCBI)