cas: 1198-63-6 — see every product listed under this CAS number, including other names
2,4,5,6-Tetrafluorobenzene-1,3-diamine (CAS 1198-63-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111POS-5g |
| cas | 1198-63-6 |
| size | 5g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 539.60 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 170.00 Pln |
| delivery time | 3 weeks |
|---|
2,4,5,6-tetrafluorobenzene-1,3-diamine (CAS 1198-63-6) is a chemical compound with the molecular formula C6H4F4N2 and a molecular weight of 180.10 g/mol. IUPAC name: 2,4,5,6-tetrafluorobenzene-1,3-diamine. InChIKey: FXGQUGCFZKMIJW-UHFFFAOYSA-N.
| Molecular formula | C6H4F4N2 |
|---|---|
| Molecular weight | 180.10 g/mol |
| IUPAC name | 2,4,5,6-tetrafluorobenzene-1,3-diamine |
| InChIKey | FXGQUGCFZKMIJW-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)N)F)N |
Computed by PubChem (NCBI)