cas: 446-17-3 — see every product listed under this CAS number, including other names
2,4,5-Trifluorobenzoic acid 96% (CAS 446-17-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A146972-10g |
| cas | 446-17-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1221.44 Pln | |
| Ambeed | 1000g | 2033.56 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A146972 |
2,4,5-trifluorobenzoic acid (CAS 446-17-3) is a chemical compound with the molecular formula C7H3F3O2 and a molecular weight of 176.09 g/mol. IUPAC name: 2,4,5-trifluorobenzoic acid. InChIKey: AKAMNXFLKYKFOJ-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O2 |
|---|---|
| Molecular weight | 176.09 g/mol |
| IUPAC name | 2,4,5-trifluorobenzoic acid |
| InChIKey | AKAMNXFLKYKFOJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)C(=O)O |
Computed by PubChem (NCBI)