cas: 446-17-3 — see every product listed under this CAS number, including other names
2,4,5-Trifluorobenzoic acid, 98%, 98% (CAS 446-17-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143YE-5g |
| cas | 446-17-3 |
| size | 5g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 50g | 117.20 Pln | |
| Chemat | 100g | 160.40 Pln | |
| Chemat | 250g | 309.20 Pln | |
| Chemat | 500g | 614.40 Pln | |
| Chemat | 1kg | 1077.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,4,5-trifluorobenzoic acid (CAS 446-17-3) is a chemical compound with the molecular formula C7H3F3O2 and a molecular weight of 176.09 g/mol. IUPAC name: 2,4,5-trifluorobenzoic acid. InChIKey: AKAMNXFLKYKFOJ-UHFFFAOYSA-N.
| Molecular formula | C7H3F3O2 |
|---|---|
| Molecular weight | 176.09 g/mol |
| IUPAC name | 2,4,5-trifluorobenzoic acid |
| InChIKey | AKAMNXFLKYKFOJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)C(=O)O |
Computed by PubChem (NCBI)