2,4-Bis(trifluoromethyl)phenylacetic acid, 97%
cas: 177952-39-5 — see every product listed under this CAS number, including other names
2,4-Bis(trifluoromethyl)phenylacetic acid, 97% (CAS 177952-39-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g, 10g, 100mg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F007830-25G |
| cas | 177952-39-5 |
| size | 25g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 4100.66 Pln | |
| Fluorochem | 250mg | 117.68 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 888.25 Pln | |
| Fluorochem | 10g | 1695.25 Pln | |
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 10g | 1460.62 Pln | |
| Ambeed | 25g | 3535.44 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2-[2,4-bis(trifluoromethyl)phenyl]acetic acid (CAS 177952-39-5) is a chemical compound with the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. IUPAC name: 2-[2,4-bis(trifluoromethyl)phenyl]acetic acid. InChIKey: BCHGLBXVODTIEE-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | 2-[2,4-bis(trifluoromethyl)phenyl]acetic acid |
| InChIKey | BCHGLBXVODTIEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,4-Bis(trifluoromethyl)phenylacetic acid, 2-[2,4-bis(trifluoromethyl)phenyl]acetic Acid, 2,4-ditrifluoromethylphenylacetic acid, Benzeneacetic acid, 2,4-bis(trifluoromethyl)-, [2,4-bis(trifluoromethyl)phenyl]acetic acid, 2-(2,4-bis(trifluoromethyl)phenyl)acetic acid, (2,4-bis-trifluoromethyl-phenyl)-acetic acid, 2,4-bis(trifluoromethyl) phenyl acetic acid