CAS 26107-80-2 appears in our catalog under these names: Methyl 3,5-bis(trifluoromethyl)benzoate, 98%, 98%, Methyl 3,5-bis(trifluoromethyl)benzoate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
Methyl 3,5-bis(trifluoromethyl)benzoate (CAS 26107-80-2) is a chemical compound with the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. IUPAC name: methyl 3,5-bis(trifluoromethyl)benzoate. InChIKey: LTYNBDAJUXZFHP-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | methyl 3,5-bis(trifluoromethyl)benzoate |
| InChIKey | LTYNBDAJUXZFHP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)