Products 88911-87-9
CAS 88911-87-9 is the registry number for 4-[2,2,2-Trifluoro-1-hydroxy-1-(trifluoromethyl)ethyl]benzaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzaldehyde (CAS 88911-87-9) is a chemical compound with the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. IUPAC name: 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzaldehyde. InChIKey: RFKXKQNQVIFBDG-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | 4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzaldehyde |
| InChIKey | RFKXKQNQVIFBDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)