CAS 177952-39-5 appears in our catalog under these names: 2,4–Bis(trifluoromethyl)phenylacetic acid, 2,4-Bis(trifluoromethyl)phenylacetic Acid, >97.0%(T), 2,4-Bis(trifluoromethyl)phenylacetic acid, 2,4-Bis(trifluoromethyl)phenylacetic acid, 97%, 97%, 2,4-Bis(trifluoromethyl)phenylacetic acid, 97%. Offered by: GLPBio, TCI, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg, 25g.
2-[2,4-bis(trifluoromethyl)phenyl]acetic acid (CAS 177952-39-5) is a chemical compound with the molecular formula C10H6F6O2 and a molecular weight of 272.14 g/mol. IUPAC name: 2-[2,4-bis(trifluoromethyl)phenyl]acetic acid. InChIKey: BCHGLBXVODTIEE-UHFFFAOYSA-N.
| Molecular formula | C10H6F6O2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | 2-[2,4-bis(trifluoromethyl)phenyl]acetic acid |
| InChIKey | BCHGLBXVODTIEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)