CAS 18625-12-2 appears in our catalog under these names: 2,4-DB methyl ester, 2,4-DB-methyl ester, 2,4-DB-methyl ester, Concentration: 100 µg/ml Solvent: Ethyl acetate. Offered by: Chemat Brand, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: on request, 250mg, 1x250mg, 1x5ml.
Methyl 4-(2,4-dichlorophenoxy)butanoate (CAS 18625-12-2) is a chemical compound with the molecular formula C11H12Cl2O3 and a molecular weight of 263.11 g/mol. IUPAC name: methyl 4-(2,4-dichlorophenoxy)butanoate. InChIKey: NKXSNMCGZZWMMW-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O3 |
|---|---|
| Molecular weight | 263.11 g/mol |
| IUPAC name | methyl 4-(2,4-dichlorophenoxy)butanoate |
| InChIKey | NKXSNMCGZZWMMW-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCOC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)