cas: 5817-92-5 — see every product listed under this CAS number, including other names
2,4-DIOXO-4-PHENYLBUTANOIC ACID, 98%, 98% (CAS 5817-92-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EBZ9-100mg |
| cas | 5817-92-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 5g | 962.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,4-dioxo-4-phenylbutanoic acid (CAS 5817-92-5) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 2,4-dioxo-4-phenylbutanoic acid. InChIKey: JGKFWCXVYCDKDU-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 2,4-dioxo-4-phenylbutanoic acid |
| InChIKey | JGKFWCXVYCDKDU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C(=O)O |
Computed by PubChem (NCBI)