CAS 90921-09-8 appears in our catalog under these names: 4-Oxochroman-7-carboxylic acid, 95%, 4–Oxochroman–7–carboxylic acid, 3,4-Dihydro-4-oxo-2H-1-benzopyran-7-carboxylic acid, 95%, 95%, 4-Oxochroman-7-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g.
4-oxo-2,3-dihydrochromene-7-carboxylic acid (CAS 90921-09-8) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 4-oxo-2,3-dihydrochromene-7-carboxylic acid. InChIKey: UMDDDSGHXQOLKM-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 4-oxo-2,3-dihydrochromene-7-carboxylic acid |
| InChIKey | UMDDDSGHXQOLKM-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)