cas: 137553-43-6 — see every product listed under this CAS number, including other names
2,4-Diamino-7-bromoquinazoline, 95%, 95% (CAS 137553-43-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1124JO-100mg |
| cas | 137553-43-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 914.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-bromoquinazoline-2,4-diamine (CAS 137553-43-6) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 7-bromoquinazoline-2,4-diamine. InChIKey: YPWBLOIRVSSESG-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 7-bromoquinazoline-2,4-diamine |
| InChIKey | YPWBLOIRVSSESG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)N=C(N=C2N)N |
Computed by PubChem (NCBI)