CAS 1123169-57-2 appears in our catalog under these names: 3-Bromo-5-methyl-2-(4h-1,2,4-triazol-4-yl)pyridine, 95%, 3-Bromo-5-methyl-2-(4H-1,2,4-triazol-4-yl)pyridine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
3-bromo-5-methyl-2-(1,2,4-triazol-4-yl)pyridine (CAS 1123169-57-2) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 3-bromo-5-methyl-2-(1,2,4-triazol-4-yl)pyridine. InChIKey: KDILRQFMVZUINC-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 3-bromo-5-methyl-2-(1,2,4-triazol-4-yl)pyridine |
| InChIKey | KDILRQFMVZUINC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)N2C=NN=C2)Br |
Computed by PubChem (NCBI)