CAS 137553-43-6 appears in our catalog under these names: 7-Bromo-2,4-diaminoquinazoline, 97%, DHFR-IN-3/ 99.61% (existing batch purity), DHFR–IN–3, 2,4-Diamino-7-bromoquinazoline, 95%, 95%, DHFR-IN-3, 99.76%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5g, 1g, 250mg, 100mg, 200mg, 50 mg, 10mM/1mL, 100 mg.
7-bromoquinazoline-2,4-diamine (CAS 137553-43-6) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 7-bromoquinazoline-2,4-diamine. InChIKey: YPWBLOIRVSSESG-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 7-bromoquinazoline-2,4-diamine |
| InChIKey | YPWBLOIRVSSESG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)N=C(N=C2N)N |
Computed by PubChem (NCBI)