CAS 1060817-73-3 is the registry number for 3-Bromo-2-methyl-6-(4h-1,2,4-triazol-4-yl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
3-bromo-2-methyl-6-(1,2,4-triazol-4-yl)pyridine (CAS 1060817-73-3) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 3-bromo-2-methyl-6-(1,2,4-triazol-4-yl)pyridine. InChIKey: MALPKFUDRJYYPA-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 3-bromo-2-methyl-6-(1,2,4-triazol-4-yl)pyridine |
| InChIKey | MALPKFUDRJYYPA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)N2C=NN=C2)Br |
Computed by PubChem (NCBI)