CAS 1129540-72-2 is the registry number for 4-(3-Bromo-1h-1,2,4-triazol-1-yl)aniline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
4-(3-bromo-1,2,4-triazol-1-yl)aniline (CAS 1129540-72-2) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 4-(3-bromo-1,2,4-triazol-1-yl)aniline. InChIKey: GYJPUYXXOGKMEE-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 4-(3-bromo-1,2,4-triazol-1-yl)aniline |
| InChIKey | GYJPUYXXOGKMEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N2C=NC(=N2)Br |
Computed by PubChem (NCBI)