CAS 54464-13-0 appears in our catalog under these names: 5-(4-Bromophenyl)-4h-1,2,4-triazol-3-amine, 95%, 5-(4-bromophenyl)-4H-1,2,4-triazol-3-amine, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g.
5-(4-bromophenyl)-1H-1,2,4-triazol-3-amine (CAS 54464-13-0) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 5-(4-bromophenyl)-1H-1,2,4-triazol-3-amine. InChIKey: VXTCEROZEXTJAB-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 5-(4-bromophenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | VXTCEROZEXTJAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NN2)N)Br |
Computed by PubChem (NCBI)