CAS 50440-75-0 is the registry number for 6-Bromo-quinazoline-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-bromoquinazoline-2,4-diamine (CAS 50440-75-0) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 6-bromoquinazoline-2,4-diamine. InChIKey: UECFPEVPPFMFOS-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 6-bromoquinazoline-2,4-diamine |
| InChIKey | UECFPEVPPFMFOS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=NC(=N2)N)N |
Computed by PubChem (NCBI)