CAS 119584-75-7 appears in our catalog under these names: 5-Bromo-quinazoline-2,4-diamine, 97%, 5-Bromoquinazoline-2,4-diamine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
5-bromoquinazoline-2,4-diamine (CAS 119584-75-7) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 5-bromoquinazoline-2,4-diamine. InChIKey: NPAVQJGHQXYNDS-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 5-bromoquinazoline-2,4-diamine |
| InChIKey | NPAVQJGHQXYNDS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=NC(=N2)N)N |
Computed by PubChem (NCBI)