cas: 28035-67-8 — see every product listed under this CAS number, including other names
2,4-Dichloro-1H-indole-3-carbaldehyde, 95+% (CAS 28035-67-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A246042-1g |
| cas | 28035-67-8 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 5317.06 Pln | |
| AmBeed | 250mg | 1606.36 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-dichloro-1H-indole-3-carbaldehyde (CAS 28035-67-8) is a chemical compound with the molecular formula C9H5Cl2NO and a molecular weight of 214.04 g/mol. IUPAC name: 2,4-dichloro-1H-indole-3-carbaldehyde. InChIKey: ZHWLJKBDGSUWRO-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NO |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | 2,4-dichloro-1H-indole-3-carbaldehyde |
| InChIKey | ZHWLJKBDGSUWRO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=C(N2)Cl)C=O |
Computed by PubChem (NCBI)