CAS 77186-41-5 is the registry number for 2-(3,4-Dichlorophenyl)-3-hydroxyacrylonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(E)-2-(3,4-dichlorophenyl)-3-hydroxyprop-2-enenitrile (CAS 77186-41-5) is a chemical compound with the molecular formula C9H5Cl2NO and a molecular weight of 214.04 g/mol. IUPAC name: (E)-2-(3,4-dichlorophenyl)-3-hydroxyprop-2-enenitrile. InChIKey: RTXZLLOYUZLNBR-ALCCZGGFSA-N.
| Molecular formula | C9H5Cl2NO |
|---|---|
| Molecular weight | 214.04 g/mol |
| IUPAC name | (E)-2-(3,4-dichlorophenyl)-3-hydroxyprop-2-enenitrile |
| InChIKey | RTXZLLOYUZLNBR-ALCCZGGFSA-N |
| SMILES | C1=CC(=C(C=C1/C(=C\O)/C#N)Cl)Cl |
Computed by PubChem (NCBI)