cas: 38902-87-3 — see every product listed under this CAS number, including other names
2,4-Dichloro-3-nitrophenol 98% (CAS 38902-87-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A653276-250mg |
| cas | 38902-87-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 298.06 Pln | |
| Ambeed | 5g | 770.88 Pln | |
| Ambeed | 25g | 2333.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A653276 |
2,4-dichloro-3-nitrophenol (CAS 38902-87-3) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 2,4-dichloro-3-nitrophenol. InChIKey: GLNRZGZHZYONRE-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO3 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 2,4-dichloro-3-nitrophenol |
| InChIKey | GLNRZGZHZYONRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)