cas: 38902-87-3 — see every product listed under this CAS number, including other names
2,4-Dichloro-3-nitrophenol, 98% (CAS 38902-87-3) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241094-500MG |
| cas | 38902-87-3 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 289.50 Pln | |
| Fluorochem | 1g | 315.53 Pln | |
| Fluorochem | 5g | 841.39 Pln | |
| Fluorochem | 10g | 1622.36 Pln | |
| Fluorochem | 25g | 2637.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,4-dichloro-3-nitrophenol (CAS 38902-87-3) is a chemical compound with the molecular formula C6H3Cl2NO3 and a molecular weight of 208.00 g/mol. IUPAC name: 2,4-dichloro-3-nitrophenol. InChIKey: GLNRZGZHZYONRE-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO3 |
|---|---|
| Molecular weight | 208.00 g/mol |
| IUPAC name | 2,4-dichloro-3-nitrophenol |
| InChIKey | GLNRZGZHZYONRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)