cas: 4487-56-3 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-nitropyridine 98% (CAS 4487-56-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A177678-100mg |
| cas | 4487-56-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 431.56 Pln | |
| Ambeed | 25g | 909.94 Pln | |
| Ambeed | 100g | 3368.56 Pln | |
| Ambeed | 500g | 16412.62 Pln | |
| Ambeed | 1000g | 26213.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A177678 |
2,4-dichloro-5-nitropyridine (CAS 4487-56-3) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,4-dichloro-5-nitropyridine. InChIKey: RZVJQUMDJUUBBF-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,4-dichloro-5-nitropyridine |
| InChIKey | RZVJQUMDJUUBBF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)