cas: 4487-56-3 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-nitropyridine, 95% (CAS 4487-56-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049487-1G |
| cas | 4487-56-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 232.23 Pln | |
| Fluorochem | 10g | 409.25 Pln | |
| Fluorochem | 25g | 857.01 Pln | |
| Fluorochem | 100g | 3267.62 Pln | |
| Fluorochem | 500g | 16138.09 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2,4-dichloro-5-nitropyridine (CAS 4487-56-3) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,4-dichloro-5-nitropyridine. InChIKey: RZVJQUMDJUUBBF-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,4-dichloro-5-nitropyridine |
| InChIKey | RZVJQUMDJUUBBF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)