cas: 4487-56-3 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-nitropyridine, 99.99% (CAS 4487-56-3) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-34054-1 g |
| cas | 4487-56-3 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 5 g | 356.84 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.99% |
2,4-dichloro-5-nitropyridine (CAS 4487-56-3) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 2,4-dichloro-5-nitropyridine. InChIKey: RZVJQUMDJUUBBF-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 2,4-dichloro-5-nitropyridine |
| InChIKey | RZVJQUMDJUUBBF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)