CAS 70593-56-5 appears in our catalog under these names: 2,4-Dichloropyridine-3-carboxamide, 2,4-Dichloropyridine-3-carboxamide, ≥95%, ≥95%, 2,4-Dichloronicotinamide, ≥95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg.
2,4-dichloropyridine-3-carboxamide (CAS 70593-56-5) is a chemical compound with the molecular formula C6H4Cl2N2O and a molecular weight of 191.01 g/mol. IUPAC name: 2,4-dichloropyridine-3-carboxamide. InChIKey: SBNBNPZOICXBQI-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 2,4-dichloropyridine-3-carboxamide |
| InChIKey | SBNBNPZOICXBQI-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)C(=O)N)Cl |
Computed by PubChem (NCBI)