CAS 1246034-32-1 is the registry number for 1-(2,6-Dichloropyrimidin-4-yl)ethanone, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
1-(2,6-dichloropyrimidin-4-yl)ethanone (CAS 1246034-32-1) is a chemical compound with the molecular formula C6H4Cl2N2O and a molecular weight of 191.01 g/mol. IUPAC name: 1-(2,6-dichloropyrimidin-4-yl)ethanone. InChIKey: QWFPWSVCWFERSW-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 1-(2,6-dichloropyrimidin-4-yl)ethanone |
| InChIKey | QWFPWSVCWFERSW-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=NC(=N1)Cl)Cl |
Computed by PubChem (NCBI)