CAS 75291-84-8 appears in our catalog under these names: 5,6-Dichloropyridine-3-carboxamide, 98%, 5,6-dichloropyridine-3-carboxamide, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 10g.
5,6-dichloropyridine-3-carboxamide (CAS 75291-84-8) is a chemical compound with the molecular formula C6H4Cl2N2O and a molecular weight of 191.01 g/mol. IUPAC name: 5,6-dichloropyridine-3-carboxamide. InChIKey: MPXFKNFJVCEHKV-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 5,6-dichloropyridine-3-carboxamide |
| InChIKey | MPXFKNFJVCEHKV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)