CAS 70593-57-6 appears in our catalog under these names: 4,6-Dichloronicotinamide, 98%, 4,6-Dichloronicotinamide 98%, 4,6-Dichloronicotinamide, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 250mg.
4,6-dichloropyridine-3-carboxamide (CAS 70593-57-6) is a chemical compound with the molecular formula C6H4Cl2N2O and a molecular weight of 191.01 g/mol. IUPAC name: 4,6-dichloropyridine-3-carboxamide. InChIKey: IQVYHPUXNYVYFW-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 4,6-dichloropyridine-3-carboxamide |
| InChIKey | IQVYHPUXNYVYFW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)C(=O)N)Cl |
Computed by PubChem (NCBI)