CAS 1807182-77-9 appears in our catalog under these names: 5,6-Dichloropyridine-2-carboxamide, 95%, 5,6-Dichloropicolinamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
5,6-dichloropyridine-2-carboxamide (CAS 1807182-77-9) is a chemical compound with the molecular formula C6H4Cl2N2O and a molecular weight of 191.01 g/mol. IUPAC name: 5,6-dichloropyridine-2-carboxamide. InChIKey: LDWCOJDHGJUTEZ-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 5,6-dichloropyridine-2-carboxamide |
| InChIKey | LDWCOJDHGJUTEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)